C33H54O7Si — CID 139190266
tert-butyl-diphenyl-[(2S,3S,5S,6R,7S)-3,7,9,9-tetramethoxy-5-(methoxymethoxy)-2,6-dimethylnonoxy]silane (PubChem CID 139190266) has the molecular formula C33H54O7Si and a molecular weight of 590.87 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2S,3S,5S,6R,7S)-3,7,9,9-tetramethoxy-5-(methoxymethoxy)-2,6-dimethylnonoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(2S,3S,5S,6R,7S)-3,7,9,9-tetramethoxy-5-(methoxymethoxy)-2,6-dimethylnonoxy]silane |
|---|---|
| PubChem CID | 139190266 |
| Molecular Formula | C33H54O7Si |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | tert-butyl-diphenyl-[(2S,3S,5S,6R,7S)-3,7,9,9-tetramethoxy-5-(methoxymethoxy)-2,6-dimethylnonoxy]silane |
| SMILES | COCO[C@@H](C[C@H](OC)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)[C@H](CC(OC)OC)OC |
| InChI | InChI=1S/C33H54O7Si/c1-25(29(35-7)21-31(39-24-34-6)26(2)30(36-8)22-32(37-9)38-10)23-40-41(33(3,4)5,27-17-13-11-14-18-27)28-19-15-12-16-20-28/h11-20,25-26,29-32H,21-24H2,1-10H3/t25-,26+,29-,30-,31-/m0/s1 |
| InChIKey | AYFSREPAVUSQCQ-ZVHCFVJJSA-N |
| XLogP | 5.25 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|