C13H15NO6 — CID 139190586
(6aR,9R,10S,10aS)-9-hydroxy-10-nitro-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-6-one;hydrate (PubChem CID 139190586) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is (6aR,9R,10S,10aS)-9-hydroxy-10-nitro-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-6-one;hydrate.
| Compound Name | (6aR,9R,10S,10aS)-9-hydroxy-10-nitro-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-6-one;hydrate |
|---|---|
| PubChem CID | 139190586 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (6aR,9R,10S,10aS)-9-hydroxy-10-nitro-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-6-one;hydrate |
| SMILES | O.O=C1Oc2ccccc2[C@H]2[C@H]([N+](=O)[O-])[C@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C13H13NO5.H2O/c15-9-6-5-8-11(12(9)14(17)18)7-3-1-2-4-10(7)19-13(8)16;/h1-4,8-9,11-12,15H,5-6H2;1H2/t8-,9-,11-,12-;/m1./s1 |
| InChIKey | IQGMNVPGWMQHIF-WFEFASIESA-N |
| XLogP | 0.28 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|