About [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate
[4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 139190656) has the molecular formula C38H40O8S2
and a molecular weight of 688.86 g/mol. Its IUPAC name is [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate |
| PubChem CID | 139190656 |
| Molecular Formula | C38H40O8S2 |
| Molecular Weight | 688.86 g/mol |
| Exact Mass | 688.22 |
| IUPAC Name | [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CC1=CCO[C@@H](c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)C1.CC1=CCO[C@@H](c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)C1 |
| InChI | InChI=1S/2C19H20O4S/c2*1-14-3-9-18(10-4-14)24(20,21)23-17-7-5-16(6-8-17)19-13-15(2)11-12-22-19/h2*3-11,19H,12-13H2,1-2H3/t2*19-/m11/s1 |
| InChIKey | MAUDTXQCYZYQRR-ARRWCHTLSA-N |
| XLogP | 8.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 688.86 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate?
The IUPAC name of [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate (CID 139190656) is [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate?
The canonical SMILES for [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate is CC1=CCO[C@@H](c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)C1.CC1=CCO[C@@H](c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)C1.
What is the InChIKey of [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate?
The InChIKey is MAUDTXQCYZYQRR-ARRWCHTLSA-N. The full InChI is InChI=1S/2C19H20O4S/c2*1-14-3-9-18(10-4-14)24(20,21)23-17-7-5-16(6-8-17)19-13-15(2)11-12-22-19/h2*3-11,19H,12-13H2,1-2H3/t2*19-/m11/s1.
What are the key properties of [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate?
[4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate has a molecular weight of 688.86 g/mol, XLogP of 8.34, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2R)-4-methyl-3,6-dihydro-2H-pyran-2-yl]phenyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 139190656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).