C24H32O6 — CID 139190698
(1R,4S,7R,8R)-7,8-dimethyl-3-oxatricyclo[5.2.2.04,8]undecane-2,9-dione (PubChem CID 139190698) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (1R,4S,7R,8R)-7,8-dimethyl-3-oxatricyclo[5.2.2.04,8]undecane-2,9-dione.
| Compound Name | (1R,4S,7R,8R)-7,8-dimethyl-3-oxatricyclo[5.2.2.04,8]undecane-2,9-dione |
|---|---|
| PubChem CID | 139190698 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (1R,4S,7R,8R)-7,8-dimethyl-3-oxatricyclo[5.2.2.04,8]undecane-2,9-dione |
| SMILES | C[C@@]12CC[C@H]3C(=O)O[C@@H](CC1)[C@]2(C)C3=O.C[C@@]12CC[C@H]3C(=O)O[C@@H](CC1)[C@]2(C)C3=O |
| InChI | InChI=1S/2C12H16O3/c2*1-11-5-3-7-9(13)12(11,2)8(4-6-11)15-10(7)14/h2*7-8H,3-6H2,1-2H3/t2*7-,8+,11-,12-/m11/s1 |
| InChIKey | JTAPCOAPWKFVLT-DPVWJMJSSA-N |
| XLogP | 3.39 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|