About 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate
2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate (PubChem CID 139191143) has the molecular formula C13H17NO6S
and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate.
Molecular Properties
| Compound Name | 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate |
| PubChem CID | 139191143 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate |
| SMILES | CC1(C)COC(CC(=O)c2ccccc2)=[NH+]1.O=S(=O)([O-])O |
| InChI | InChI=1S/C13H15NO2.H2O4S/c1-13(2)9-16-12(14-13)8-11(15)10-6-4-3-5-7-10;1-5(2,3)4/h3-7H,8-9H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | FFDFVPNIKWYETM-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate?
The IUPAC name of 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate (CID 139191143) is 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate.
What is the SMILES notation for 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate?
The canonical SMILES for 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate is CC1(C)COC(CC(=O)c2ccccc2)=[NH+]1.O=S(=O)([O-])O.
What is the InChIKey of 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate?
The InChIKey is FFDFVPNIKWYETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2.H2O4S/c1-13(2)9-16-12(14-13)8-11(15)10-6-4-3-5-7-10;1-5(2,3)4/h3-7H,8-9H2,1-2H3;(H2,1,2,3,4).
What are the key properties of 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate?
2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate has a molecular weight of 315.35 g/mol, XLogP of -0.45, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-5H-1,3-oxazol-3-ium-2-yl)-1-phenylethanone;hydrogen sulfate is sourced from PubChem (CID 139191143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).