C13H14O5 — CID 139191168
(1S,4S,6S,10S,11S,16R)-6-methyl-5,9,13,15-tetraoxapentacyclo[8.4.2.01,11.04,16.06,10]hexadec-2-en-8-one (PubChem CID 139191168) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is (1S,4S,6S,10S,11S,16R)-6-methyl-5,9,13,15-tetraoxapentacyclo[8.4.2.01,11.04,16.06,10]hexadec-2-en-8-one.
| Compound Name | (1S,4S,6S,10S,11S,16R)-6-methyl-5,9,13,15-tetraoxapentacyclo[8.4.2.01,11.04,16.06,10]hexadec-2-en-8-one |
|---|---|
| PubChem CID | 139191168 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (1S,4S,6S,10S,11S,16R)-6-methyl-5,9,13,15-tetraoxapentacyclo[8.4.2.01,11.04,16.06,10]hexadec-2-en-8-one |
| SMILES | C[C@]12CC(=O)O[C@@]13[C@@H]1O[C@]4(C=C[C@@H]1O2)COC[C@H]34 |
| InChI | InChI=1S/C13H14O5/c1-11-4-9(14)17-13(11)8-5-15-6-12(8)3-2-7(16-11)10(13)18-12/h2-3,7-8,10H,4-6H2,1H3/t7-,8-,10+,11-,12+,13-/m0/s1 |
| InChIKey | WWFMWGVOANGEBU-YDMHIXMGSA-N |
| XLogP | 0.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|