C47H71BBrN3O2 — CID 139191356
2-[(6E)-6-(3,4-diethylpyrrol-1-ium-2-ylidene)-2,2-diphenyl-1,3-dioxa-2-boranuidacyclohex-4-en-4-yl]-3,4-diethyl-1H-pyrrole;tetrabutylazanium;bromide (PubChem CID 139191356) has the molecular formula C47H71BBrN3O2 and a molecular weight of 800.82 g/mol. Its IUPAC name is 2-[(6E)-6-(3,4-diethylpyrrol-1-ium-2-ylidene)-2,2-diphenyl-1,3-dioxa-2-boranuidacyclohex-4-en-4-yl]-3,4-diethyl-1H-pyrrole;tetrabutylazanium;bromide.
| Compound Name | 2-[(6E)-6-(3,4-diethylpyrrol-1-ium-2-ylidene)-2,2-diphenyl-1,3-dioxa-2-boranuidacyclohex-4-en-4-yl]-3,4-diethyl-1H-pyrrole;tetrabutylazanium;bromide |
|---|---|
| PubChem CID | 139191356 |
| Molecular Formula | C47H71BBrN3O2 |
| Molecular Weight | 800.82 g/mol |
| Exact Mass | 799.48 |
| IUPAC Name | 2-[(6E)-6-(3,4-diethylpyrrol-1-ium-2-ylidene)-2,2-diphenyl-1,3-dioxa-2-boranuidacyclohex-4-en-4-yl]-3,4-diethyl-1H-pyrrole;tetrabutylazanium;bromide |
| SMILES | CCC1=C(CC)/C(=C2/C=C(c3[nH]cc(CC)c3CC)O[B-](c3ccccc3)(c3ccccc3)O2)[NH+]=C1.CCCC[N+](CCCC)(CCCC)CCCC.[Br-] |
| InChI | InChI=1S/C31H34BN2O2.C16H36N.BrH/c1-5-22-20-33-30(26(22)7-3)28-19-29(31-27(8-4)23(6-2)21-34-31)36-32(35-28,24-15-11-9-12-16-24)25-17-13-10-14-18-25;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h9-21,33H,5-8H2,1-4H3;5-16H2,1-4H3;1H/q-1;+1;/b31-29+;; |
| InChIKey | ZGOKONFOUPKVON-YNCMJKCTSA-N |
| XLogP | 6.28 |
| TPSA | 48.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.82 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|