C14H18Br2 — CID 139191496
(1S,2S,3S,4S,7R,8S,9S,10S,11R,12R)-8,11-dibromopentacyclo[8.4.0.02,7.03,12.04,9]tetradecane (PubChem CID 139191496) has the molecular formula C14H18Br2 and a molecular weight of 346.11 g/mol. Its IUPAC name is (1S,2S,3S,4S,7R,8S,9S,10S,11R,12R)-8,11-dibromopentacyclo[8.4.0.02,7.03,12.04,9]tetradecane.
| Compound Name | (1S,2S,3S,4S,7R,8S,9S,10S,11R,12R)-8,11-dibromopentacyclo[8.4.0.02,7.03,12.04,9]tetradecane |
|---|---|
| PubChem CID | 139191496 |
| Molecular Formula | C14H18Br2 |
| Molecular Weight | 346.11 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | (1S,2S,3S,4S,7R,8S,9S,10S,11R,12R)-8,11-dibromopentacyclo[8.4.0.02,7.03,12.04,9]tetradecane |
| SMILES | Br[C@@H]1[C@@H]2CC[C@H]3[C@@H]4[C@H]5CC[C@@H]([C@H]24)[C@H]([C@H]5Br)[C@@H]13 |
| InChI | InChI=1S/C14H18Br2/c15-13-7-3-1-5-9-8-4-2-6(10(7)9)12(11(5)13)14(8)16/h5-14H,1-4H2/t5-,6-,7+,8+,9+,10+,11-,12-,13-,14+/m0/s1 |
| InChIKey | ZVUKOXVBWQTNPV-HZLMNOCVSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.11 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|