C16H25NO3 — CID 139191668
(4S)-3-[(1R,2S)-2-ethenyl-1,2-diethylcyclopropanecarbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 139191668) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (4S)-3-[(1R,2S)-2-ethenyl-1,2-diethylcyclopropanecarbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(1R,2S)-2-ethenyl-1,2-diethylcyclopropanecarbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139191668 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (4S)-3-[(1R,2S)-2-ethenyl-1,2-diethylcyclopropanecarbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@]1(CC)C[C@@]1(CC)C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C16H25NO3/c1-6-15(7-2)10-16(15,8-3)13(18)17-12(11(4)5)9-20-14(17)19/h6,11-12H,1,7-10H2,2-5H3/t12-,15+,16+/m1/s1 |
| InChIKey | CDCKIDZZUCNCPT-KCXAZCMYSA-N |
| XLogP | 3.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|