C9H11IO3 — CID 139191755
(3R,3aS,7aR)-7a-hydroxy-3-(iodomethyl)-3,3a,6,7-tetrahydro-2-benzofuran-1-one (PubChem CID 139191755) has the molecular formula C9H11IO3 and a molecular weight of 294.09 g/mol. Its IUPAC name is (3R,3aS,7aR)-7a-hydroxy-3-(iodomethyl)-3,3a,6,7-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3R,3aS,7aR)-7a-hydroxy-3-(iodomethyl)-3,3a,6,7-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139191755 |
| Molecular Formula | C9H11IO3 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | (3R,3aS,7aR)-7a-hydroxy-3-(iodomethyl)-3,3a,6,7-tetrahydro-2-benzofuran-1-one |
| SMILES | O=C1O[C@@H](CI)[C@@H]2C=CCC[C@]12O |
| InChI | InChI=1S/C9H11IO3/c10-5-7-6-3-1-2-4-9(6,12)8(11)13-7/h1,3,6-7,12H,2,4-5H2/t6-,7-,9+/m0/s1 |
| InChIKey | OLRJLSRDDJDMIP-ACLDMZEESA-N |
| XLogP | 1.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|