C27H56O6Si3 — CID 139191839
methyl (3R,4S,5R,7R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octane-7-carboxylate (PubChem CID 139191839) has the molecular formula C27H56O6Si3 and a molecular weight of 561.00 g/mol. Its IUPAC name is methyl (3R,4S,5R,7R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octane-7-carboxylate.
| Compound Name | methyl (3R,4S,5R,7R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octane-7-carboxylate |
|---|---|
| PubChem CID | 139191839 |
| Molecular Formula | C27H56O6Si3 |
| Molecular Weight | 561.00 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | methyl (3R,4S,5R,7R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octane-7-carboxylate |
| SMILES | COC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@]2(CO2)C1 |
| InChI | InChI=1S/C27H56O6Si3/c1-23(2,3)34(11,12)31-20-17-26(22(28)29-10,33-36(15,16)25(7,8)9)18-27(19-30-27)21(20)32-35(13,14)24(4,5)6/h20-21H,17-19H2,1-16H3/t20-,21+,26-,27-/m1/s1 |
| InChIKey | URSBPMIJIUSAOW-SJRZMVRYSA-N |
| XLogP | 7.26 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.00 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|