About CID 139192072
CID 139192072 (PubChem CID 139192072) has the molecular formula C24H24Br2N2O3S
and a molecular weight of 580.34 g/mol.
Molecular Properties
| Compound Name | CID 139192072 |
| PubChem CID | 139192072 |
| Molecular Formula | C24H24Br2N2O3S |
| Molecular Weight | 580.34 g/mol |
| Exact Mass | 577.99 |
| IUPAC Name | — |
| SMILES | CCCN1C(=O)[C@]2(SC[C@H](O)[C@]23C(=O)N(CCC)c2cc(Br)ccc23)c2ccc(Br)cc21 |
| InChI | InChI=1S/C24H24Br2N2O3S/c1-3-9-27-18-11-14(25)5-7-16(18)23(21(27)30)20(29)13-32-24(23)17-8-6-15(26)12-19(17)28(10-4-2)22(24)31/h5-8,11-12,20,29H,3-4,9-10,13H2,1-2H3/t20-,23+,24+/m0/s1 |
| InChIKey | RCJWYGNVSMPTMV-TUACAJSNSA-N |
| XLogP | 4.97 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 580.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 139192072 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139192072?
The IUPAC name of CID 139192072 (CID 139192072) is not available.
What is the SMILES notation for CID 139192072?
The canonical SMILES for CID 139192072 is CCCN1C(=O)[C@]2(SC[C@H](O)[C@]23C(=O)N(CCC)c2cc(Br)ccc23)c2ccc(Br)cc21.
What is the InChIKey of CID 139192072?
The InChIKey is RCJWYGNVSMPTMV-TUACAJSNSA-N. The full InChI is InChI=1S/C24H24Br2N2O3S/c1-3-9-27-18-11-14(25)5-7-16(18)23(21(27)30)20(29)13-32-24(23)17-8-6-15(26)12-19(17)28(10-4-2)22(24)31/h5-8,11-12,20,29H,3-4,9-10,13H2,1-2H3/t20-,23+,24+/m0/s1.
What are the key properties of CID 139192072?
CID 139192072 has a molecular weight of 580.34 g/mol, XLogP of 4.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139192072 is sourced from PubChem (CID 139192072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).