C44H32F6N2O2 — CID 139192178
(4R)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine;(4S)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine (PubChem CID 139192178) has the molecular formula C44H32F6N2O2 and a molecular weight of 734.74 g/mol. Its IUPAC name is (4R)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine;(4S)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine.
| Compound Name | (4R)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine;(4S)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine |
|---|---|
| PubChem CID | 139192178 |
| Molecular Formula | C44H32F6N2O2 |
| Molecular Weight | 734.74 g/mol |
| Exact Mass | 734.24 |
| IUPAC Name | (4R)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine;(4S)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine |
| SMILES | FC(F)(F)C[C@@]1(c2ccccc2)OC(c2ccccc2)=Nc2ccccc21.FC(F)(F)C[C@]1(c2ccccc2)OC(c2ccccc2)=Nc2ccccc21 |
| InChI | InChI=1S/2C22H16F3NO/c2*23-22(24,25)15-21(17-11-5-2-6-12-17)18-13-7-8-14-19(18)26-20(27-21)16-9-3-1-4-10-16/h2*1-14H,15H2/t2*21-/m10/s1 |
| InChIKey | XXDLNEKFLULLFG-FUAXNEBDSA-N |
| XLogP | 11.98 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.74 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |