C22H16F3NO — CID 139192180
(4S)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine (PubChem CID 139192180) has the molecular formula C22H16F3NO and a molecular weight of 367.37 g/mol. Its IUPAC name is (4S)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine.
| Compound Name | (4S)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine |
|---|---|
| PubChem CID | 139192180 |
| Molecular Formula | C22H16F3NO |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (4S)-2,4-diphenyl-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine |
| SMILES | FC(F)(F)C[C@@]1(c2ccccc2)OC(c2ccccc2)=Nc2ccccc21 |
| InChI | InChI=1S/C22H16F3NO/c23-22(24,25)15-21(17-11-5-2-6-12-17)18-13-7-8-14-19(18)26-20(27-21)16-9-3-1-4-10-16/h1-14H,15H2/t21-/m0/s1 |
| InChIKey | OXMYQCBTXQBBFG-NRFANRHFSA-N |
| XLogP | 5.99 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |