C22H32ClNO2 — CID 139192208
(3S,6R,8R,10S,13S)-13-[(S)-chloro(phenyl)methyl]-2,2,6,13-tetramethyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 139192208) has the molecular formula C22H32ClNO2 and a molecular weight of 377.96 g/mol. Its IUPAC name is (3S,6R,8R,10S,13S)-13-[(S)-chloro(phenyl)methyl]-2,2,6,13-tetramethyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,13S)-13-[(S)-chloro(phenyl)methyl]-2,2,6,13-tetramethyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 139192208 |
| Molecular Formula | C22H32ClNO2 |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (3S,6R,8R,10S,13S)-13-[(S)-chloro(phenyl)methyl]-2,2,6,13-tetramethyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1CO[C@](C)([C@@H](Cl)c3ccccc3)CN1C2(C)C |
| InChI | InChI=1S/C22H32ClNO2/c1-15-10-11-17-18(12-15)26-19-13-25-22(4,14-24(19)21(17,2)3)20(23)16-8-6-5-7-9-16/h5-9,15,17-20H,10-14H2,1-4H3/t15-,17-,18-,19+,20+,22+/m1/s1 |
| InChIKey | YIQUQODHXCOLNC-LBXJCDLNSA-N |
| XLogP | 5.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|