C17H10BF10N — CID 139192249
bis(2,3,4,5,6-pentafluorophenyl)-piperidin-1-ylborane (PubChem CID 139192249) has the molecular formula C17H10BF10N and a molecular weight of 429.07 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-piperidin-1-ylborane.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-piperidin-1-ylborane |
|---|---|
| PubChem CID | 139192249 |
| Molecular Formula | C17H10BF10N |
| Molecular Weight | 429.07 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-piperidin-1-ylborane |
| SMILES | Fc1c(F)c(F)c(B(c2c(F)c(F)c(F)c(F)c2F)N2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C17H10BF10N/c19-8-6(9(20)13(24)16(27)12(8)23)18(29-4-2-1-3-5-29)7-10(21)14(25)17(28)15(26)11(7)22/h1-5H2 |
| InChIKey | OSNJECBYNDPYQF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.07 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|