C20H34O2 — CID 139192346
(1R,4E,8E,12R,16S)-4,8,12,14,14-pentamethyl-13-oxabicyclo[10.2.2]hexadeca-4,8-dien-16-ol (PubChem CID 139192346) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1R,4E,8E,12R,16S)-4,8,12,14,14-pentamethyl-13-oxabicyclo[10.2.2]hexadeca-4,8-dien-16-ol.
| Compound Name | (1R,4E,8E,12R,16S)-4,8,12,14,14-pentamethyl-13-oxabicyclo[10.2.2]hexadeca-4,8-dien-16-ol |
|---|---|
| PubChem CID | 139192346 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1R,4E,8E,12R,16S)-4,8,12,14,14-pentamethyl-13-oxabicyclo[10.2.2]hexadeca-4,8-dien-16-ol |
| SMILES | C/C1=C\CC[C@@]2(C)OC(C)(C)[C@H](CC/C(C)=C/CC1)C[C@@H]2O |
| InChI | InChI=1S/C20H34O2/c1-15-8-6-9-16(2)11-12-17-14-18(21)20(5,13-7-10-15)22-19(17,3)4/h9-10,17-18,21H,6-8,11-14H2,1-5H3/b15-10+,16-9+/t17-,18+,20-/m1/s1 |
| InChIKey | QJAIARJGTZFFBW-CALKCLNRSA-N |
| XLogP | 5.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|