C20H25F4NO3 — CID 139192362
[(1S)-2-(tert-butylamino)-2-oxo-1-[(2R,3S,5R,6S)-2,3,5,6-tetrafluoro-1-methylcyclohexyl]ethyl] benzoate (PubChem CID 139192362) has the molecular formula C20H25F4NO3 and a molecular weight of 403.42 g/mol. Its IUPAC name is [(1S)-2-(tert-butylamino)-2-oxo-1-[(2R,3S,5R,6S)-2,3,5,6-tetrafluoro-1-methylcyclohexyl]ethyl] benzoate.
| Compound Name | [(1S)-2-(tert-butylamino)-2-oxo-1-[(2R,3S,5R,6S)-2,3,5,6-tetrafluoro-1-methylcyclohexyl]ethyl] benzoate |
|---|---|
| PubChem CID | 139192362 |
| Molecular Formula | C20H25F4NO3 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [(1S)-2-(tert-butylamino)-2-oxo-1-[(2R,3S,5R,6S)-2,3,5,6-tetrafluoro-1-methylcyclohexyl]ethyl] benzoate |
| SMILES | CC(C)(C)NC(=O)[C@@H](OC(=O)c1ccccc1)C1(C)[C@H](F)[C@H](F)C[C@H](F)[C@@H]1F |
| InChI | InChI=1S/C20H25F4NO3/c1-19(2,3)25-17(26)16(28-18(27)11-8-6-5-7-9-11)20(4)14(23)12(21)10-13(22)15(20)24/h5-9,12-16H,10H2,1-4H3,(H,25,26)/t12-,13+,14-,15+,16-,20?/m1/s1 |
| InChIKey | GZNUCWRMSDIMHT-HEWXODPTSA-N |
| XLogP | 3.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |