C52H38N6O2 — CID 139192534
4-(4-methoxynaphthalen-1-yl)-2,6-dipyridin-2-ylpyridine (PubChem CID 139192534) has the molecular formula C52H38N6O2 and a molecular weight of 778.92 g/mol. Its IUPAC name is 4-(4-methoxynaphthalen-1-yl)-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-(4-methoxynaphthalen-1-yl)-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 139192534 |
| Molecular Formula | C52H38N6O2 |
| Molecular Weight | 778.92 g/mol |
| Exact Mass | 778.31 |
| IUPAC Name | 4-(4-methoxynaphthalen-1-yl)-2,6-dipyridin-2-ylpyridine |
| SMILES | COc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)c2ccccc12.COc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)c2ccccc12 |
| InChI | InChI=1S/2C26H19N3O/c2*1-30-26-13-12-19(20-8-2-3-9-21(20)26)18-16-24(22-10-4-6-14-27-22)29-25(17-18)23-11-5-7-15-28-23/h2*2-17H,1H3 |
| InChIKey | JFWYNTUAGMSCEO-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.92 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |