C27H30NO8P — CID 139192580
benzyl (2R,3S)-2-diethoxyphosphoryloxy-4-nitro-2,3-diphenylbutanoate (PubChem CID 139192580) has the molecular formula C27H30NO8P and a molecular weight of 527.51 g/mol. Its IUPAC name is benzyl (2R,3S)-2-diethoxyphosphoryloxy-4-nitro-2,3-diphenylbutanoate.
| Compound Name | benzyl (2R,3S)-2-diethoxyphosphoryloxy-4-nitro-2,3-diphenylbutanoate |
|---|---|
| PubChem CID | 139192580 |
| Molecular Formula | C27H30NO8P |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | benzyl (2R,3S)-2-diethoxyphosphoryloxy-4-nitro-2,3-diphenylbutanoate |
| SMILES | CCOP(=O)(OCC)O[C@@](C(=O)OCc1ccccc1)(c1ccccc1)[C@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C27H30NO8P/c1-3-34-37(32,35-4-2)36-27(24-18-12-7-13-19-24,26(29)33-21-22-14-8-5-9-15-22)25(20-28(30)31)23-16-10-6-11-17-23/h5-19,25H,3-4,20-21H2,1-2H3/t25-,27+/m1/s1 |
| InChIKey | VSROBVDBISKZOT-VPUSJEBWSA-N |
| XLogP | 5.88 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|