C18H19BrN2O6 — CID 139192624
methyl (3S,3aR,6aS)-5-(4-bromophenyl)-3-(2-methoxy-2-oxoethyl)-2-methyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 139192624) has the molecular formula C18H19BrN2O6 and a molecular weight of 439.26 g/mol. Its IUPAC name is methyl (3S,3aR,6aS)-5-(4-bromophenyl)-3-(2-methoxy-2-oxoethyl)-2-methyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (3S,3aR,6aS)-5-(4-bromophenyl)-3-(2-methoxy-2-oxoethyl)-2-methyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 139192624 |
| Molecular Formula | C18H19BrN2O6 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | methyl (3S,3aR,6aS)-5-(4-bromophenyl)-3-(2-methoxy-2-oxoethyl)-2-methyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)C[C@@]1(C(=O)OC)[C@@H]2C(=O)N(c3ccc(Br)cc3)C(=O)[C@@H]2CN1C |
| InChI | InChI=1S/C18H19BrN2O6/c1-20-9-12-14(18(20,17(25)27-3)8-13(22)26-2)16(24)21(15(12)23)11-6-4-10(19)5-7-11/h4-7,12,14H,8-9H2,1-3H3/t12-,14+,18+/m1/s1 |
| InChIKey | OVKBWLFJIHNCOW-IAISJRAMSA-N |
| XLogP | 0.98 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|