C23H24F3NO5 — CID 139192801
methyl (2R)-2-formamido-2-[(2S,4S,6S)-2-phenyl-6-(2-phenylethyl)-2-(trifluoromethyl)-1,3-dioxan-4-yl]acetate (PubChem CID 139192801) has the molecular formula C23H24F3NO5 and a molecular weight of 451.44 g/mol. Its IUPAC name is methyl (2R)-2-formamido-2-[(2S,4S,6S)-2-phenyl-6-(2-phenylethyl)-2-(trifluoromethyl)-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl (2R)-2-formamido-2-[(2S,4S,6S)-2-phenyl-6-(2-phenylethyl)-2-(trifluoromethyl)-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 139192801 |
| Molecular Formula | C23H24F3NO5 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | methyl (2R)-2-formamido-2-[(2S,4S,6S)-2-phenyl-6-(2-phenylethyl)-2-(trifluoromethyl)-1,3-dioxan-4-yl]acetate |
| SMILES | COC(=O)[C@H](NC=O)[C@@H]1C[C@H](CCc2ccccc2)O[C@](c2ccccc2)(C(F)(F)F)O1 |
| InChI | InChI=1S/C23H24F3NO5/c1-30-21(29)20(27-15-28)19-14-18(13-12-16-8-4-2-5-9-16)31-22(32-19,23(24,25)26)17-10-6-3-7-11-17/h2-11,15,18-20H,12-14H2,1H3,(H,27,28)/t18-,19-,20+,22-/m0/s1 |
| InChIKey | WZDCUIBOFOYFFP-KEZQHZCBSA-N |
| XLogP | 3.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|