About (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one
(Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one (PubChem CID 139192893) has the molecular formula C29H21BrO2
and a molecular weight of 481.39 g/mol. Its IUPAC name is (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one.
Molecular Properties
| Compound Name | (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one |
| PubChem CID | 139192893 |
| Molecular Formula | C29H21BrO2 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one |
| SMILES | O=C(C(/C(=C\c1ccccc1)c1ccccc1)=C(\O)c1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C29H21BrO2/c30-26-19-11-10-18-24(26)29(32)27(28(31)23-16-8-3-9-17-23)25(22-14-6-2-7-15-22)20-21-12-4-1-5-13-21/h1-20,31H/b25-20-,28-27- |
| InChIKey | HUUPHEPTAQSYMR-GNAGIPHVSA-N |
| XLogP | 7.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one?
The IUPAC name of (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one (CID 139192893) is (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one.
What is the SMILES notation for (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one?
The canonical SMILES for (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one is O=C(C(/C(=C\c1ccccc1)c1ccccc1)=C(\O)c1ccccc1)c1ccccc1Br.
What is the InChIKey of (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one?
The InChIKey is HUUPHEPTAQSYMR-GNAGIPHVSA-N. The full InChI is InChI=1S/C29H21BrO2/c30-26-19-11-10-18-24(26)29(32)27(28(31)23-16-8-3-9-17-23)25(22-14-6-2-7-15-22)20-21-12-4-1-5-13-21/h1-20,31H/b25-20-,28-27-.
What are the key properties of (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one?
(Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one has a molecular weight of 481.39 g/mol, XLogP of 7.84, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2Z)-1-(2-bromophenyl)-2-[hydroxy(phenyl)methylidene]-3,4-diphenylbut-3-en-1-one is sourced from PubChem (CID 139192893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).