C17H14F3NO2S — CID 139192935
(NE)-4-methyl-N-[(E)-4,4,4-trifluoro-1-phenylbut-2-enylidene]benzenesulfonamide (PubChem CID 139192935) has the molecular formula C17H14F3NO2S and a molecular weight of 353.37 g/mol. Its IUPAC name is (NE)-4-methyl-N-[(E)-4,4,4-trifluoro-1-phenylbut-2-enylidene]benzenesulfonamide.
| Compound Name | (NE)-4-methyl-N-[(E)-4,4,4-trifluoro-1-phenylbut-2-enylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 139192935 |
| Molecular Formula | C17H14F3NO2S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | (NE)-4-methyl-N-[(E)-4,4,4-trifluoro-1-phenylbut-2-enylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(\C=C\C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H14F3NO2S/c1-13-7-9-15(10-8-13)24(22,23)21-16(11-12-17(18,19)20)14-5-3-2-4-6-14/h2-12H,1H3/b12-11+,21-16+ |
| InChIKey | SSZUWPLRZDRTJN-XOWWARPTSA-N |
| XLogP | 4.29 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|