C35H30Cl2N4O8S2 — CID 139193089
dichloromethane;bis(methyl (3S)-3-(1H-indol-3-yl)-1,1-dioxo-2H-1,2-benzothiazole-3-carboxylate) (PubChem CID 139193089) has the molecular formula C35H30Cl2N4O8S2 and a molecular weight of 769.69 g/mol. Its IUPAC name is dichloromethane;bis(methyl (3S)-3-(1H-indol-3-yl)-1,1-dioxo-2H-1,2-benzothiazole-3-carboxylate).
| Compound Name | dichloromethane;bis(methyl (3S)-3-(1H-indol-3-yl)-1,1-dioxo-2H-1,2-benzothiazole-3-carboxylate) |
|---|---|
| PubChem CID | 139193089 |
| Molecular Formula | C35H30Cl2N4O8S2 |
| Molecular Weight | 769.69 g/mol |
| Exact Mass | 768.09 |
| IUPAC Name | dichloromethane;bis(methyl (3S)-3-(1H-indol-3-yl)-1,1-dioxo-2H-1,2-benzothiazole-3-carboxylate) |
| SMILES | COC(=O)[C@@]1(c2c[nH]c3ccccc23)NS(=O)(=O)c2ccccc21.COC(=O)[C@@]1(c2c[nH]c3ccccc23)NS(=O)(=O)c2ccccc21.ClCCl |
| InChI | InChI=1S/2C17H14N2O4S.CH2Cl2/c2*1-23-16(20)17(13-10-18-14-8-4-2-6-11(13)14)12-7-3-5-9-15(12)24(21,22)19-17;2-1-3/h2*2-10,18-19H,1H3;1H2/t2*17-;/m11./s1 |
| InChIKey | WTJNJXQLRSZQOR-NCTGSHGJSA-N |
| XLogP | 5.17 |
| TPSA | 176.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.69 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|