C10H15NO5 — CID 139193122
dimethyl (2S,5S)-1-acetylpyrrolidine-2,5-dicarboxylate (PubChem CID 139193122) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is dimethyl (2S,5S)-1-acetylpyrrolidine-2,5-dicarboxylate.
| Compound Name | dimethyl (2S,5S)-1-acetylpyrrolidine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 139193122 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | dimethyl (2S,5S)-1-acetylpyrrolidine-2,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C(=O)OC)N1C(C)=O |
| InChI | InChI=1S/C10H15NO5/c1-6(12)11-7(9(13)15-2)4-5-8(11)10(14)16-3/h7-8H,4-5H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | AGPIKHCBGWQOGF-YUMQZZPRSA-N |
| XLogP | -0.29 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |