C49H60N4O4 — CID 139193620
N-(8-benzamido-9H-carbazol-1-yl)benzamide;tetrabutylazanium;benzoate (PubChem CID 139193620) has the molecular formula C49H60N4O4 and a molecular weight of 769.04 g/mol. Its IUPAC name is N-(8-benzamido-9H-carbazol-1-yl)benzamide;tetrabutylazanium;benzoate.
| Compound Name | N-(8-benzamido-9H-carbazol-1-yl)benzamide;tetrabutylazanium;benzoate |
|---|---|
| PubChem CID | 139193620 |
| Molecular Formula | C49H60N4O4 |
| Molecular Weight | 769.04 g/mol |
| Exact Mass | 768.46 |
| IUPAC Name | N-(8-benzamido-9H-carbazol-1-yl)benzamide;tetrabutylazanium;benzoate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C(Nc1cccc2c1[nH]c1c(NC(=O)c3ccccc3)cccc12)c1ccccc1.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C26H19N3O2.C16H36N.C7H6O2/c30-25(17-9-3-1-4-10-17)27-21-15-7-13-19-20-14-8-16-22(24(20)29-23(19)21)28-26(31)18-11-5-2-6-12-18;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-7(9)6-4-2-1-3-5-6/h1-16,29H,(H,27,30)(H,28,31);5-16H2,1-4H3;1-5H,(H,8,9)/q;+1;/p-1 |
| InChIKey | GROPQUYORZOARG-UHFFFAOYSA-M |
| XLogP | 10.88 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.04 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|