C9H17N3S — CID 139193797
(5S,5aS,9aS)-5-methyl-1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,2,4]triazepine-3-thione (PubChem CID 139193797) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is (5S,5aS,9aS)-5-methyl-1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,2,4]triazepine-3-thione.
| Compound Name | (5S,5aS,9aS)-5-methyl-1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,2,4]triazepine-3-thione |
|---|---|
| PubChem CID | 139193797 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | (5S,5aS,9aS)-5-methyl-1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,2,4]triazepine-3-thione |
| SMILES | C[C@@H]1NC(=S)NN[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C9H17N3S/c1-6-7-4-2-3-5-8(7)11-12-9(13)10-6/h6-8,11H,2-5H2,1H3,(H2,10,12,13)/t6-,7-,8-/m0/s1 |
| InChIKey | HSDSRDHLNJGIDT-FXQIFTODSA-N |
| XLogP | 0.92 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|