C21H18Cl2O3S — CID 139193820
(2Z)-4,6-dichloro-2-(4,7-dimethoxy-2,2-dimethyl-3H-inden-1-ylidene)-1-benzothiophen-3-one (PubChem CID 139193820) has the molecular formula C21H18Cl2O3S and a molecular weight of 421.35 g/mol. Its IUPAC name is (2Z)-4,6-dichloro-2-(4,7-dimethoxy-2,2-dimethyl-3H-inden-1-ylidene)-1-benzothiophen-3-one.
| Compound Name | (2Z)-4,6-dichloro-2-(4,7-dimethoxy-2,2-dimethyl-3H-inden-1-ylidene)-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 139193820 |
| Molecular Formula | C21H18Cl2O3S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | (2Z)-4,6-dichloro-2-(4,7-dimethoxy-2,2-dimethyl-3H-inden-1-ylidene)-1-benzothiophen-3-one |
| SMILES | COc1ccc(OC)c2c1CC(C)(C)/C2=C1/Sc2cc(Cl)cc(Cl)c2C1=O |
| InChI | InChI=1S/C21H18Cl2O3S/c1-21(2)9-11-13(25-3)5-6-14(26-4)16(11)18(21)20-19(24)17-12(23)7-10(22)8-15(17)27-20/h5-8H,9H2,1-4H3/b20-18+ |
| InChIKey | PSYIRHCHLZSLET-CZIZESTLSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|