C28H23NO5 — CID 139193963
(2R,3R,3aR,9bR)-3a-phenacyl-3-phenylspiro[3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,3'-oxolane]-2',4-dione (PubChem CID 139193963) has the molecular formula C28H23NO5 and a molecular weight of 453.49 g/mol. Its IUPAC name is (2R,3R,3aR,9bR)-3a-phenacyl-3-phenylspiro[3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,3'-oxolane]-2',4-dione.
| Compound Name | (2R,3R,3aR,9bR)-3a-phenacyl-3-phenylspiro[3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,3'-oxolane]-2',4-dione |
|---|---|
| PubChem CID | 139193963 |
| Molecular Formula | C28H23NO5 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (2R,3R,3aR,9bR)-3a-phenacyl-3-phenylspiro[3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,3'-oxolane]-2',4-dione |
| SMILES | O=C(C[C@]12C(=O)Oc3ccccc3[C@H]1N[C@]1(CCOC1=O)[C@@H]2c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23NO5/c30-21(18-9-3-1-4-10-18)17-27-23(19-11-5-2-6-12-19)28(15-16-33-26(28)32)29-24(27)20-13-7-8-14-22(20)34-25(27)31/h1-14,23-24,29H,15-17H2/t23-,24-,27-,28-/m1/s1 |
| InChIKey | CXVUURAFIOULRC-NFFAYCCRSA-N |
| XLogP | 3.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|