About [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate
[(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate (PubChem CID 139193987) has the molecular formula C21H24N2O6S
and a molecular weight of 432.50 g/mol. Its IUPAC name is [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate.
Molecular Properties
| Compound Name | [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate |
| PubChem CID | 139193987 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H](C)C[C@H]2COC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H24N2O6S/c1-15-3-9-20(10-4-15)30(27,28)22-12-11-16(2)13-19(22)14-29-21(24)17-5-7-18(8-6-17)23(25)26/h3-10,16,19H,11-14H2,1-2H3/t16-,19-/m0/s1 |
| InChIKey | SFSARPGUYMIPIL-LPHOPBHVSA-N |
| XLogP | 3.55 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate?
The IUPAC name of [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate (CID 139193987) is [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate.
What is the SMILES notation for [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate?
The canonical SMILES for [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate is Cc1ccc(S(=O)(=O)N2CC[C@H](C)C[C@H]2COC(=O)c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate?
The InChIKey is SFSARPGUYMIPIL-LPHOPBHVSA-N. The full InChI is InChI=1S/C21H24N2O6S/c1-15-3-9-20(10-4-15)30(27,28)22-12-11-16(2)13-19(22)14-29-21(24)17-5-7-18(8-6-17)23(25)26/h3-10,16,19H,11-14H2,1-2H3/t16-,19-/m0/s1.
What are the key properties of [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate?
[(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate has a molecular weight of 432.50 g/mol, XLogP of 3.55, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-4-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methyl 4-nitrobenzoate is sourced from PubChem (CID 139193987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).