C40H30N2O6S2 — CID 139194022
4-[(1R,2R)-2-phenylcyclopropyl]benzo[h][1,2,3]benzoxathiazine 2,2-dioxide;4-[(1S,2S)-2-phenylcyclopropyl]benzo[h][1,2,3]benzoxathiazine 2,2-dioxide (PubChem CID 139194022) has the molecular formula C40H30N2O6S2 and a molecular weight of 698.82 g/mol. Its IUPAC name is 4-[(1R,2R)-2-phenylcyclopropyl]benzo[h][1,2,3]benzoxathiazine 2,2-dioxide;4-[(1S,2S)-2-phenylcyclopropyl]benzo[h][1,2,3]benzoxathiazine 2,2-dioxide.
| Compound Name | 4-[(1R,2R)-2-phenylcyclopropyl]benzo[h][1,2,3]benzoxathiazine 2,2-dioxide;4-[(1S,2S)-2-phenylcyclopropyl]benzo[h][1,2,3]benzoxathiazine 2,2-dioxide |
|---|---|
| PubChem CID | 139194022 |
| Molecular Formula | C40H30N2O6S2 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 698.15 |
| IUPAC Name | 4-[(1R,2R)-2-phenylcyclopropyl]benzo[h][1,2,3]benzoxathiazine 2,2-dioxide;4-[(1S,2S)-2-phenylcyclopropyl]benzo[h][1,2,3]benzoxathiazine 2,2-dioxide |
| SMILES | O=S1(=O)N=C([C@@H]2C[C@H]2c2ccccc2)c2ccc3ccccc3c2O1.O=S1(=O)N=C([C@H]2C[C@@H]2c2ccccc2)c2ccc3ccccc3c2O1 |
| InChI | InChI=1S/2C20H15NO3S/c2*22-25(23)21-19(18-12-17(18)13-6-2-1-3-7-13)16-11-10-14-8-4-5-9-15(14)20(16)24-25/h2*1-11,17-18H,12H2/t2*17-,18+/m10/s1 |
| InChIKey | IUMMRBSHUVPVDX-QVUSPSOHSA-N |
| XLogP | 8.14 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |