About CID 139194174
CID 139194174 (PubChem CID 139194174) has the molecular formula C92H68Cl2N8
and a molecular weight of 1356.52 g/mol.
Molecular Properties
| Compound Name | CID 139194174 |
| PubChem CID | 139194174 |
| Molecular Formula | C92H68Cl2N8 |
| Molecular Weight | 1356.52 g/mol |
| Exact Mass | 1354.49 |
| IUPAC Name | — |
| SMILES | ClCCCl.Cn1cc2cc1[C+](c1ccccc1)c1ccc([n-]1)/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)c1ccc([n-]1)[C+]2c1ccccc1.Cn1cc2cc1[C+](c1ccccc1)c1ccc([n-]1)/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)c1ccc([n-]1)[C+]2c1ccccc1 |
| InChI | InChI=1S/2C45H32N4.C2H4Cl2/c2*1-49-29-34-28-41(49)45(33-20-12-5-13-21-33)40-27-26-39(48-40)44(32-18-10-4-11-19-32)38-25-24-37(47-38)43(31-16-8-3-9-17-31)36-23-22-35(46-36)42(34)30-14-6-2-7-15-30;3-1-2-4/h2*2-29,47H,1H3;1-2H2/b2*43-37-,44-38-; |
| InChIKey | WQWBFFNVCSOPHR-XDUWSROQSA-N |
| XLogP | 15.69 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 102 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1356.52 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 139194174 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139194174?
The IUPAC name of CID 139194174 (CID 139194174) is not available.
What is the SMILES notation for CID 139194174?
The canonical SMILES for CID 139194174 is ClCCCl.Cn1cc2cc1[C+](c1ccccc1)c1ccc([n-]1)/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)c1ccc([n-]1)[C+]2c1ccccc1.Cn1cc2cc1[C+](c1ccccc1)c1ccc([n-]1)/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)c1ccc([n-]1)[C+]2c1ccccc1.
What is the InChIKey of CID 139194174?
The InChIKey is WQWBFFNVCSOPHR-XDUWSROQSA-N. The full InChI is InChI=1S/2C45H32N4.C2H4Cl2/c2*1-49-29-34-28-41(49)45(33-20-12-5-13-21-33)40-27-26-39(48-40)44(32-18-10-4-11-19-32)38-25-24-37(47-38)43(31-16-8-3-9-17-31)36-23-22-35(46-36)42(34)30-14-6-2-7-15-30;3-1-2-4/h2*2-29,47H,1H3;1-2H2/b2*43-37-,44-38-;.
What are the key properties of CID 139194174?
CID 139194174 has a molecular weight of 1356.52 g/mol, XLogP of 15.69, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139194174 is sourced from PubChem (CID 139194174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).