C40H42N6O6 — CID 139194322
2,4-bis(3,5-dimethylphenoxy)-6-methoxy-1,3,5-triazine (PubChem CID 139194322) has the molecular formula C40H42N6O6 and a molecular weight of 702.81 g/mol. Its IUPAC name is 2,4-bis(3,5-dimethylphenoxy)-6-methoxy-1,3,5-triazine.
| Compound Name | 2,4-bis(3,5-dimethylphenoxy)-6-methoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 139194322 |
| Molecular Formula | C40H42N6O6 |
| Molecular Weight | 702.81 g/mol |
| Exact Mass | 702.32 |
| IUPAC Name | 2,4-bis(3,5-dimethylphenoxy)-6-methoxy-1,3,5-triazine |
| SMILES | COc1nc(Oc2cc(C)cc(C)c2)nc(Oc2cc(C)cc(C)c2)n1.COc1nc(Oc2cc(C)cc(C)c2)nc(Oc2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/2C20H21N3O3/c2*1-12-6-13(2)9-16(8-12)25-19-21-18(24-5)22-20(23-19)26-17-10-14(3)7-15(4)11-17/h2*6-11H,1-5H3 |
| InChIKey | MCTXPFPPMXKCAW-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 132.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.81 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |