C11H5F4NO — CID 139194338
5,6,7,8-tetrafluoronaphthalene-2-carboxamide (PubChem CID 139194338) has the molecular formula C11H5F4NO and a molecular weight of 243.16 g/mol. Its IUPAC name is 5,6,7,8-tetrafluoronaphthalene-2-carboxamide.
| Compound Name | 5,6,7,8-tetrafluoronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 139194338 |
| Molecular Formula | C11H5F4NO |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 5,6,7,8-tetrafluoronaphthalene-2-carboxamide |
| SMILES | NC(=O)c1ccc2c(F)c(F)c(F)c(F)c2c1 |
| InChI | InChI=1S/C11H5F4NO/c12-7-5-2-1-4(11(16)17)3-6(5)8(13)10(15)9(7)14/h1-3H,(H2,16,17) |
| InChIKey | HXNIKMQCPPEJPI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|