About bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid
bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid (PubChem CID 139194371) has the molecular formula C49H36N4O8
and a molecular weight of 808.85 g/mol. Its IUPAC name is bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid.
Molecular Properties
| Compound Name | bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid |
| PubChem CID | 139194371 |
| Molecular Formula | C49H36N4O8 |
| Molecular Weight | 808.85 g/mol |
| Exact Mass | 808.25 |
| IUPAC Name | bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(c2ccc(C(=O)O)cc2)(c2ccc(C(=O)O)cc2)c2ccc(C(=O)O)cc2)cc1.c1cc(-c2ccncc2)ccn1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C29H20O8.2C10H8N2/c30-25(31)17-1-9-21(10-2-17)29(22-11-3-18(4-12-22)26(32)33,23-13-5-19(6-14-23)27(34)35)24-15-7-20(8-16-24)28(36)37;2*1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-16H,(H,30,31)(H,32,33)(H,34,35)(H,36,37);2*1-8H |
| InChIKey | VEBSZASMKMVWTQ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 200.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 808.85 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid?
The IUPAC name of bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid (CID 139194371) is bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid.
What is the SMILES notation for bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid?
The canonical SMILES for bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid is O=C(O)c1ccc(C(c2ccc(C(=O)O)cc2)(c2ccc(C(=O)O)cc2)c2ccc(C(=O)O)cc2)cc1.c1cc(-c2ccncc2)ccn1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid?
The InChIKey is VEBSZASMKMVWTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H20O8.2C10H8N2/c30-25(31)17-1-9-21(10-2-17)29(22-11-3-18(4-12-22)26(32)33,23-13-5-19(6-14-23)27(34)35)24-15-7-20(8-16-24)28(36)37;2*1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-16H,(H,30,31)(H,32,33)(H,34,35)(H,36,37);2*1-8H.
What are the key properties of bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid?
bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid has a molecular weight of 808.85 g/mol, XLogP of 9.15, 10 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-pyridin-4-ylpyridine);4-[tris(4-carboxyphenyl)methyl]benzoic acid is sourced from PubChem (CID 139194371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).