C23H31NO2 — CID 139194384
piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol (PubChem CID 139194384) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol.
| Compound Name | piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol |
|---|---|
| PubChem CID | 139194384 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol |
| SMILES | C1CCNCC1.CC1(C)C[C@@](C)(c2ccc(O)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C18H20O2.C5H11N/c1-17(2)12-18(3,13-8-10-14(19)11-9-13)15-6-4-5-7-16(15)20-17;1-2-4-6-5-3-1/h4-11,19H,12H2,1-3H3;6H,1-5H2/t18-;/m0./s1 |
| InChIKey | ZTJUXZJFYKFPOO-FERBBOLQSA-N |
| XLogP | 5.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |