About piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol
piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol (PubChem CID 139194384) has the molecular formula C23H31NO2
and a molecular weight of 353.51 g/mol. Its IUPAC name is piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol.
Molecular Properties
| Compound Name | piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol |
| PubChem CID | 139194384 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol |
| SMILES | C1CCNCC1.CC1(C)C[C@@](C)(c2ccc(O)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C18H20O2.C5H11N/c1-17(2)12-18(3,13-8-10-14(19)11-9-13)15-6-4-5-7-16(15)20-17;1-2-4-6-5-3-1/h4-11,19H,12H2,1-3H3;6H,1-5H2/t18-;/m0./s1 |
| InChIKey | ZTJUXZJFYKFPOO-FERBBOLQSA-N |
| XLogP | 5.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol?
The IUPAC name of piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol (CID 139194384) is piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol.
What is the SMILES notation for piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol?
The canonical SMILES for piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol is C1CCNCC1.CC1(C)C[C@@](C)(c2ccc(O)cc2)c2ccccc2O1.
What is the InChIKey of piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol?
The InChIKey is ZTJUXZJFYKFPOO-FERBBOLQSA-N. The full InChI is InChI=1S/C18H20O2.C5H11N/c1-17(2)12-18(3,13-8-10-14(19)11-9-13)15-6-4-5-7-16(15)20-17;1-2-4-6-5-3-1/h4-11,19H,12H2,1-3H3;6H,1-5H2/t18-;/m0./s1.
What are the key properties of piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol?
piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol has a molecular weight of 353.51 g/mol, XLogP of 5.02, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;4-[(4S)-2,2,4-trimethyl-3H-chromen-4-yl]phenol is sourced from PubChem (CID 139194384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).