C18H10F2N2O4 — CID 139194385
2,5-difluoro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;phenazine (PubChem CID 139194385) has the molecular formula C18H10F2N2O4 and a molecular weight of 356.28 g/mol. Its IUPAC name is 2,5-difluoro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;phenazine.
| Compound Name | 2,5-difluoro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;phenazine |
|---|---|
| PubChem CID | 139194385 |
| Molecular Formula | C18H10F2N2O4 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2,5-difluoro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;phenazine |
| SMILES | O=C1C(O)=C(F)C(=O)C(O)=C1F.c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C12H8N2.C6H2F2O4/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;7-1-3(9)5(11)2(8)6(12)4(1)10/h1-8H;9,12H |
| InChIKey | UMELNMNIMPVRLE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|