About [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate
[(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate (PubChem CID 139194513) has the molecular formula C15H31F3N2O3S
and a molecular weight of 376.49 g/mol. Its IUPAC name is [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate |
| PubChem CID | 139194513 |
| Molecular Formula | C15H31F3N2O3S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate |
| SMILES | CCCCN(CCCC)[C@@H]1CCCC[C@H]1[NH3+].O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H30N2.CHF3O3S/c1-3-5-11-16(12-6-4-2)14-10-8-7-9-13(14)15;2-1(3,4)8(5,6)7/h13-14H,3-12,15H2,1-2H3;(H,5,6,7)/t13-,14-;/m1./s1 |
| InChIKey | HZRXXRXDXDWUDY-DTPOWOMPSA-N |
| XLogP | 2.49 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate?
The IUPAC name of [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate (CID 139194513) is [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate.
What is the SMILES notation for [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate?
The canonical SMILES for [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate is CCCCN(CCCC)[C@@H]1CCCC[C@H]1[NH3+].O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate?
The InChIKey is HZRXXRXDXDWUDY-DTPOWOMPSA-N. The full InChI is InChI=1S/C14H30N2.CHF3O3S/c1-3-5-11-16(12-6-4-2)14-10-8-7-9-13(14)15;2-1(3,4)8(5,6)7/h13-14H,3-12,15H2,1-2H3;(H,5,6,7)/t13-,14-;/m1./s1.
What are the key properties of [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate?
[(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate has a molecular weight of 376.49 g/mol, XLogP of 2.49, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-(dibutylamino)cyclohexyl]azanium;trifluoromethanesulfonate is sourced from PubChem (CID 139194513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).