About 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide
1,4-diazabicyclo[2.2.2]octane;ethanedithioamide (PubChem CID 139194724) has the molecular formula C8H16N4S2
and a molecular weight of 232.38 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide.
Molecular Properties
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide |
| PubChem CID | 139194724 |
| Molecular Formula | C8H16N4S2 |
| Molecular Weight | 232.38 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide |
| SMILES | C1CN2CCN1CC2.NC(=S)C(N)=S |
| InChI | InChI=1S/C6H12N2.C2H4N2S2/c1-2-8-5-3-7(1)4-6-8;3-1(5)2(4)6/h1-6H2;(H2,3,5)(H2,4,6) |
| InChIKey | LMRKSYSIWZBWAL-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.38 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide?
The IUPAC name of 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide (CID 139194724) is 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide.
What is the SMILES notation for 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide?
The canonical SMILES for 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide is C1CN2CCN1CC2.NC(=S)C(N)=S.
What is the InChIKey of 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide?
The InChIKey is LMRKSYSIWZBWAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.C2H4N2S2/c1-2-8-5-3-7(1)4-6-8;3-1(5)2(4)6/h1-6H2;(H2,3,5)(H2,4,6).
What are the key properties of 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide?
1,4-diazabicyclo[2.2.2]octane;ethanedithioamide has a molecular weight of 232.38 g/mol, XLogP of -0.82, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazabicyclo[2.2.2]octane;ethanedithioamide is sourced from PubChem (CID 139194724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).