C24H27ClF3NO2 — CID 139194752
acetic acid;[(1R)-1-naphthalen-1-ylethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]azanium;chloride (PubChem CID 139194752) has the molecular formula C24H27ClF3NO2 and a molecular weight of 453.93 g/mol. Its IUPAC name is acetic acid;[(1R)-1-naphthalen-1-ylethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]azanium;chloride.
| Compound Name | acetic acid;[(1R)-1-naphthalen-1-ylethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]azanium;chloride |
|---|---|
| PubChem CID | 139194752 |
| Molecular Formula | C24H27ClF3NO2 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | acetic acid;[(1R)-1-naphthalen-1-ylethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]azanium;chloride |
| SMILES | CC(=O)O.C[C@@H]([NH2+]CCCc1cccc(C(F)(F)F)c1)c1cccc2ccccc12.[Cl-] |
| InChI | InChI=1S/C22H22F3N.C2H4O2.ClH/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25;1-2(3)4;/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3;1H3,(H,3,4);1H/t16-;;/m1../s1 |
| InChIKey | MFAQYRWXFUAZOE-GGMCWBHBSA-N |
| XLogP | 2.21 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|