C42H36N2O4 — CID 139194839
(1R,2R,5S,6S)-2,6-dimethyl-3,7-diazatricyclo[4.2.2.22,5]dodeca-9,11-diene-4,8-dione;1,1,6,6-tetraphenylhexa-2,4-diyne-1,6-diol (PubChem CID 139194839) has the molecular formula C42H36N2O4 and a molecular weight of 632.76 g/mol. Its IUPAC name is (1R,2R,5S,6S)-2,6-dimethyl-3,7-diazatricyclo[4.2.2.22,5]dodeca-9,11-diene-4,8-dione;1,1,6,6-tetraphenylhexa-2,4-diyne-1,6-diol.
| Compound Name | (1R,2R,5S,6S)-2,6-dimethyl-3,7-diazatricyclo[4.2.2.22,5]dodeca-9,11-diene-4,8-dione;1,1,6,6-tetraphenylhexa-2,4-diyne-1,6-diol |
|---|---|
| PubChem CID | 139194839 |
| Molecular Formula | C42H36N2O4 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | (1R,2R,5S,6S)-2,6-dimethyl-3,7-diazatricyclo[4.2.2.22,5]dodeca-9,11-diene-4,8-dione;1,1,6,6-tetraphenylhexa-2,4-diyne-1,6-diol |
| SMILES | C[C@]12C=C[C@H](C(=O)N1)[C@]1(C)C=C[C@H]2C(=O)N1.OC(C#CC#CC(O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H22O2.C12H14N2O2/c31-29(25-15-5-1-6-16-25,26-17-7-2-8-18-26)23-13-14-24-30(32,27-19-9-3-10-20-27)28-21-11-4-12-22-28;1-11-5-3-8(10(16)13-11)12(2)6-4-7(11)9(15)14-12/h1-12,15-22,31-32H;3-8H,1-2H3,(H,13,16)(H,14,15)/t;7-,8+,11+,12- |
| InChIKey | ZNBHPZCCRQQJFP-STZXNRSDSA-N |
| XLogP | 4.99 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|