C52H36Cl4N4OS2 — CID 139195011
bis(dichloromethane);N,N-diphenyl-4-[2-[5-[5-[5-[2-[4-(N-phenylanilino)phenyl]ethynyl]thiophen-2-yl]-1,3,4-oxadiazol-2-yl]thiophen-2-yl]ethynyl]aniline (PubChem CID 139195011) has the molecular formula C52H36Cl4N4OS2 and a molecular weight of 938.83 g/mol. Its IUPAC name is bis(dichloromethane);N,N-diphenyl-4-[2-[5-[5-[5-[2-[4-(N-phenylanilino)phenyl]ethynyl]thiophen-2-yl]-1,3,4-oxadiazol-2-yl]thiophen-2-yl]ethynyl]aniline.
| Compound Name | bis(dichloromethane);N,N-diphenyl-4-[2-[5-[5-[5-[2-[4-(N-phenylanilino)phenyl]ethynyl]thiophen-2-yl]-1,3,4-oxadiazol-2-yl]thiophen-2-yl]ethynyl]aniline |
|---|---|
| PubChem CID | 139195011 |
| Molecular Formula | C52H36Cl4N4OS2 |
| Molecular Weight | 938.83 g/mol |
| Exact Mass | 936.11 |
| IUPAC Name | bis(dichloromethane);N,N-diphenyl-4-[2-[5-[5-[5-[2-[4-(N-phenylanilino)phenyl]ethynyl]thiophen-2-yl]-1,3,4-oxadiazol-2-yl]thiophen-2-yl]ethynyl]aniline |
| SMILES | C(#Cc1ccc(-c2nnc(-c3ccc(C#Cc4ccc(N(c5ccccc5)c5ccccc5)cc4)s3)o2)s1)c1ccc(N(c2ccccc2)c2ccccc2)cc1.ClCCl.ClCCl |
| InChI | InChI=1S/C50H32N4OS2.2CH2Cl2/c1-5-13-39(14-6-1)53(40-15-7-2-8-16-40)43-27-21-37(22-28-43)25-31-45-33-35-47(56-45)49-51-52-50(55-49)48-36-34-46(57-48)32-26-38-23-29-44(30-24-38)54(41-17-9-3-10-18-41)42-19-11-4-12-20-42;2*2-1-3/h1-24,27-30,33-36H;2*1H2 |
| InChIKey | MAOPYUNFGSDNCG-UHFFFAOYSA-N |
| XLogP | 16.11 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.83 |
| LogP ≤ 5 | 16.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|