C15H2BrF8N — CID 139195056
4-[(E)-2-(4-bromo-2,3,5,6-tetrafluorophenyl)ethenyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 139195056) has the molecular formula C15H2BrF8N and a molecular weight of 428.08 g/mol. Its IUPAC name is 4-[(E)-2-(4-bromo-2,3,5,6-tetrafluorophenyl)ethenyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[(E)-2-(4-bromo-2,3,5,6-tetrafluorophenyl)ethenyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 139195056 |
| Molecular Formula | C15H2BrF8N |
| Molecular Weight | 428.08 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | 4-[(E)-2-(4-bromo-2,3,5,6-tetrafluorophenyl)ethenyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1c(F)c(F)c(/C=C/c2c(F)c(F)c(Br)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C15H2BrF8N/c16-7-14(23)10(19)5(11(20)15(7)24)2-1-4-8(17)12(21)6(3-25)13(22)9(4)18/h1-2H/b2-1+ |
| InChIKey | MJNXICAOMYFVLJ-OWOJBTEDSA-N |
| XLogP | 5.60 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.08 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|