C37H39NO11 — CID 139195666
2,4,5-tricarboxybenzoate;tris[2-(4-methylphenoxy)ethyl]azanium (PubChem CID 139195666) has the molecular formula C37H39NO11 and a molecular weight of 673.71 g/mol. Its IUPAC name is 2,4,5-tricarboxybenzoate;tris[2-(4-methylphenoxy)ethyl]azanium.
| Compound Name | 2,4,5-tricarboxybenzoate;tris[2-(4-methylphenoxy)ethyl]azanium |
|---|---|
| PubChem CID | 139195666 |
| Molecular Formula | C37H39NO11 |
| Molecular Weight | 673.71 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | 2,4,5-tricarboxybenzoate;tris[2-(4-methylphenoxy)ethyl]azanium |
| SMILES | Cc1ccc(OCC[NH+](CCOc2ccc(C)cc2)CCOc2ccc(C)cc2)cc1.O=C([O-])c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C27H33NO3.C10H6O8/c1-22-4-10-25(11-5-22)29-19-16-28(17-20-30-26-12-6-23(2)7-13-26)18-21-31-27-14-8-24(3)9-15-27;11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h4-15H,16-21H2,1-3H3;1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | LOWOIUQNXIJTIC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 184.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |