C48H36F6O8 — CID 139195707
diethyl 4-[4,5-bis(ethoxycarbonyl)-2-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]-5-[4-(3,4,5-trifluorophenyl)phenyl]benzene-1,2-dicarboxylate (PubChem CID 139195707) has the molecular formula C48H36F6O8 and a molecular weight of 854.80 g/mol. Its IUPAC name is diethyl 4-[4,5-bis(ethoxycarbonyl)-2-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]-5-[4-(3,4,5-trifluorophenyl)phenyl]benzene-1,2-dicarboxylate.
| Compound Name | diethyl 4-[4,5-bis(ethoxycarbonyl)-2-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]-5-[4-(3,4,5-trifluorophenyl)phenyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139195707 |
| Molecular Formula | C48H36F6O8 |
| Molecular Weight | 854.80 g/mol |
| Exact Mass | 854.23 |
| IUPAC Name | diethyl 4-[4,5-bis(ethoxycarbonyl)-2-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]-5-[4-(3,4,5-trifluorophenyl)phenyl]benzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(-c3cc(F)c(F)c(F)c3)cc2)c(-c2cc(C(=O)OCC)c(C(=O)OCC)cc2-c2ccc(-c3cc(F)c(F)c(F)c3)cc2)cc1C(=O)OCC |
| InChI | InChI=1S/C48H36F6O8/c1-5-59-45(55)35-21-31(27-13-9-25(10-14-27)29-17-39(49)43(53)40(50)18-29)33(23-37(35)47(57)61-7-3)34-24-38(48(58)62-8-4)36(46(56)60-6-2)22-32(34)28-15-11-26(12-16-28)30-19-41(51)44(54)42(52)20-30/h9-24H,5-8H2,1-4H3 |
| InChIKey | PNMKMXXXDSLMID-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.80 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|