About 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate
3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate (PubChem CID 139195978) has the molecular formula C13H17N3O5
and a molecular weight of 295.30 g/mol. Its IUPAC name is 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate.
Molecular Properties
| Compound Name | 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate |
| PubChem CID | 139195978 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate |
| SMILES | CCc1ccccc1[NH3+].O.O=C(O)c1cc(C(=O)[O-])[nH]n1 |
| InChI | InChI=1S/C8H11N.C5H4N2O4.H2O/c1-2-7-5-3-4-6-8(7)9;8-4(9)2-1-3(5(10)11)7-6-2;/h3-6H,2,9H2,1H3;1H,(H,6,7)(H,8,9)(H,10,11);1H2 |
| InChIKey | ZUDFCMGWMAEURI-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate?
The IUPAC name of 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate (CID 139195978) is 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate.
What is the SMILES notation for 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate?
The canonical SMILES for 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate is CCc1ccccc1[NH3+].O.O=C(O)c1cc(C(=O)[O-])[nH]n1.
What is the InChIKey of 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate?
The InChIKey is ZUDFCMGWMAEURI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C5H4N2O4.H2O/c1-2-7-5-3-4-6-8(7)9;8-4(9)2-1-3(5(10)11)7-6-2;/h3-6H,2,9H2,1H3;1H,(H,6,7)(H,8,9)(H,10,11);1H2.
What are the key properties of 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate?
3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate has a molecular weight of 295.30 g/mol, XLogP of -1.23, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carboxy-1H-pyrazole-5-carboxylate;(2-ethylphenyl)azanium;hydrate is sourced from PubChem (CID 139195978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).