About 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline
4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline (PubChem CID 139196022) has the molecular formula C20H12N2O7PbS
and a molecular weight of 631.59 g/mol. Its IUPAC name is 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline.
Molecular Properties
| Compound Name | 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline |
| PubChem CID | 139196022 |
| Molecular Formula | C20H12N2O7PbS |
| Molecular Weight | 631.59 g/mol |
| Exact Mass | 632.01 |
| IUPAC Name | 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline |
| SMILES | O=C([O-])c1ccc(C(=O)O)c(S(=O)(=O)[O-])c1.[Pb+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C8H6O7S.Pb/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;9-7(10)4-1-2-5(8(11)12)6(3-4)16(13,14)15;/h1-8H;1-3H,(H,9,10)(H,11,12)(H,13,14,15);/q;;+2/p-2 |
| InChIKey | GCOJQPZDCPXONX-UHFFFAOYSA-L |
| XLogP | 1.05 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 631.59 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline?
The IUPAC name of 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline (CID 139196022) is 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline.
What is the SMILES notation for 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline?
The canonical SMILES for 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline is O=C([O-])c1ccc(C(=O)O)c(S(=O)(=O)[O-])c1.[Pb+2].c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline?
The InChIKey is GCOJQPZDCPXONX-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H8N2.C8H6O7S.Pb/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;9-7(10)4-1-2-5(8(11)12)6(3-4)16(13,14)15;/h1-8H;1-3H,(H,9,10)(H,11,12)(H,13,14,15);/q;;+2/p-2.
What are the key properties of 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline?
4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline has a molecular weight of 631.59 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carboxy-3-sulfonatobenzoate;lead(2+);1,10-phenanthroline is sourced from PubChem (CID 139196022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).