C8H12F10N2O4S2 — CID 139196126
bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;tetramethylazanium (PubChem CID 139196126) has the molecular formula C8H12F10N2O4S2 and a molecular weight of 454.31 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;tetramethylazanium.
| Compound Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;tetramethylazanium |
|---|---|
| PubChem CID | 139196126 |
| Molecular Formula | C8H12F10N2O4S2 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;tetramethylazanium |
| SMILES | C[N+](C)(C)C.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4F10NO4S2.C4H12N/c5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10;1-5(2,3)4/h;1-4H3/q-1;+1 |
| InChIKey | RWFUYWJHEUIYIY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|