About benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine
benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine (PubChem CID 139196668) has the molecular formula C19H16N4O2
and a molecular weight of 332.36 g/mol. Its IUPAC name is benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine.
Molecular Properties
| Compound Name | benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine |
| PubChem CID | 139196668 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine |
| SMILES | Oc1cccc(O)c1.c1cn(-c2ccc(-c3cncnc3)cc2)cn1 |
| InChI | InChI=1S/C13H10N4.C6H6O2/c1-3-13(17-6-5-14-10-17)4-2-11(1)12-7-15-9-16-8-12;7-5-2-1-3-6(8)4-5/h1-10H;1-4,7-8H |
| InChIKey | WZFJJFNWNCUXAT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine?
The IUPAC name of benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine (CID 139196668) is benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine.
What is the SMILES notation for benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine?
The canonical SMILES for benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine is Oc1cccc(O)c1.c1cn(-c2ccc(-c3cncnc3)cc2)cn1.
What is the InChIKey of benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine?
The InChIKey is WZFJJFNWNCUXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4.C6H6O2/c1-3-13(17-6-5-14-10-17)4-2-11(1)12-7-15-9-16-8-12;7-5-2-1-3-6(8)4-5/h1-10H;1-4,7-8H.
What are the key properties of benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine?
benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine has a molecular weight of 332.36 g/mol, XLogP of 3.43, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;5-(4-imidazol-1-ylphenyl)pyrimidine is sourced from PubChem (CID 139196668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).